C35H32Cl2N4O6S2 — CID 16635183
ethyl 4-[(8S)-4-[2-(3,4-dichloroanilino)-2-oxoethyl]-8-[4-(diethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 16635183) has the molecular formula C35H32Cl2N4O6S2 and a molecular weight of 739.70 g/mol. Its IUPAC name is ethyl 4-[(8S)-4-[2-(3,4-dichloroanilino)-2-oxoethyl]-8-[4-(diethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(8S)-4-[2-(3,4-dichloroanilino)-2-oxoethyl]-8-[4-(diethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 16635183 |
| Molecular Formula | C35H32Cl2N4O6S2 |
| Molecular Weight | 739.70 g/mol |
| Exact Mass | 738.11 |
| IUPAC Name | ethyl 4-[(8S)-4-[2-(3,4-dichloroanilino)-2-oxoethyl]-8-[4-(diethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)Nc4ccc(Cl)c(Cl)c4)[C@H](c4ccc(N(CC)CC)cc4)C3C2=O)cc1 |
| InChI | InChI=1S/C35H32Cl2N4O6S2/c1-4-39(5-2)22-12-7-19(8-13-22)27-28-29(32(44)41(31(28)43)23-14-9-20(10-15-23)34(45)47-6-3)48-33-30(27)49-35(46)40(33)18-26(42)38-21-11-16-24(36)25(37)17-21/h7-17,27-29H,4-6,18H2,1-3H3,(H,38,42)/t27-,28?,29?/m1/s1 |
| InChIKey | DVEAAIBJNBXVRP-JMYZALGVSA-N |
| XLogP | 6.67 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.70 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|