C30H21ClF3N3O4S2 — CID 103596701
2-[(8S)-8-(4-chlorophenyl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide (PubChem CID 103596701) has the molecular formula C30H21ClF3N3O4S2 and a molecular weight of 644.10 g/mol. Its IUPAC name is 2-[(8S)-8-(4-chlorophenyl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(8S)-8-(4-chlorophenyl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 103596701 |
| Molecular Formula | C30H21ClF3N3O4S2 |
| Molecular Weight | 644.10 g/mol |
| Exact Mass | 643.06 |
| IUPAC Name | 2-[(8S)-8-(4-chlorophenyl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2c3c(sc2=O)[C@H](c2ccc(Cl)cc2)C2C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)C2S3)cc1 |
| InChI | InChI=1S/C30H21ClF3N3O4S2/c1-15-5-11-19(12-6-15)35-21(38)14-36-28-25(43-29(36)41)22(16-7-9-18(31)10-8-16)23-24(42-28)27(40)37(26(23)39)20-4-2-3-17(13-20)30(32,33)34/h2-13,22-24H,14H2,1H3,(H,35,38)/t22-,23?,24?/m1/s1 |
| InChIKey | AIZBDDVMGALAHR-ZKMFCFPVSA-N |
| XLogP | 6.32 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.10 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|