C33H31N3O5S2 — CID 19248831
2-[(1R,8R,9R)-8-(4-tert-butylphenyl)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide (PubChem CID 19248831) has the molecular formula C33H31N3O5S2 and a molecular weight of 613.76 g/mol. Its IUPAC name is 2-[(1R,8R,9R)-8-(4-tert-butylphenyl)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide.
| Compound Name | 2-[(1R,8R,9R)-8-(4-tert-butylphenyl)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 19248831 |
| Molecular Formula | C33H31N3O5S2 |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.17 |
| IUPAC Name | 2-[(1R,8R,9R)-8-(4-tert-butylphenyl)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide |
| SMILES | COc1ccc(N2C(=O)[C@H]3[C@H](c4ccc(C(C)(C)C)cc4)c4sc(=O)n(CC(=O)Nc5ccccc5)c4S[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C33H31N3O5S2/c1-33(2,3)20-12-10-19(11-13-20)25-26-27(30(39)36(29(26)38)22-14-16-23(41-4)17-15-22)42-31-28(25)43-32(40)35(31)18-24(37)34-21-8-6-5-7-9-21/h5-17,25-27H,18H2,1-4H3,(H,34,37)/t25-,26-,27+/m0/s1 |
| InChIKey | GEVDBVRSSSGRLL-GMQQYTKMSA-N |
| XLogP | 5.65 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|