C30H26F3N3O2S — CID 18875728
(2Z)-2-cyano-N-(3-methylphenyl)-2-[4-oxo-3-(4-propan-2-ylphenyl)-5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-2-ylidene]acetamide (PubChem CID 18875728) has the molecular formula C30H26F3N3O2S and a molecular weight of 549.62 g/mol. Its IUPAC name is (2Z)-2-cyano-N-(3-methylphenyl)-2-[4-oxo-3-(4-propan-2-ylphenyl)-5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-2-ylidene]acetamide.
| Compound Name | (2Z)-2-cyano-N-(3-methylphenyl)-2-[4-oxo-3-(4-propan-2-ylphenyl)-5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 18875728 |
| Molecular Formula | C30H26F3N3O2S |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | (2Z)-2-cyano-N-(3-methylphenyl)-2-[4-oxo-3-(4-propan-2-ylphenyl)-5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-2-ylidene]acetamide |
| SMILES | Cc1cccc(NC(=O)/C(C#N)=C2\SC(Cc3cccc(C(F)(F)F)c3)C(=O)N2c2ccc(C(C)C)cc2)c1 |
| InChI | InChI=1S/C30H26F3N3O2S/c1-18(2)21-10-12-24(13-11-21)36-28(38)26(16-20-7-5-8-22(15-20)30(31,32)33)39-29(36)25(17-34)27(37)35-23-9-4-6-19(3)14-23/h4-15,18,26H,16H2,1-3H3,(H,35,37)/b29-25- |
| InChIKey | UPWJOLSDYGNHJG-GNVQSUKOSA-N |
| XLogP | 7.20 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|