C29H26FN3O2S — CID 18875718
(2Z)-2-cyano-2-[5-[(2-fluorophenyl)methyl]-4-oxo-3-(4-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-N-(3-methylphenyl)acetamide (PubChem CID 18875718) has the molecular formula C29H26FN3O2S and a molecular weight of 499.61 g/mol. Its IUPAC name is (2Z)-2-cyano-2-[5-[(2-fluorophenyl)methyl]-4-oxo-3-(4-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-N-(3-methylphenyl)acetamide.
| Compound Name | (2Z)-2-cyano-2-[5-[(2-fluorophenyl)methyl]-4-oxo-3-(4-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 18875718 |
| Molecular Formula | C29H26FN3O2S |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | (2Z)-2-cyano-2-[5-[(2-fluorophenyl)methyl]-4-oxo-3-(4-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)/C(C#N)=C2\SC(Cc3ccccc3F)C(=O)N2c2ccc(C(C)C)cc2)c1 |
| InChI | InChI=1S/C29H26FN3O2S/c1-18(2)20-11-13-23(14-12-20)33-28(35)26(16-21-8-4-5-10-25(21)30)36-29(33)24(17-31)27(34)32-22-9-6-7-19(3)15-22/h4-15,18,26H,16H2,1-3H3,(H,32,34)/b29-24- |
| InChIKey | FJGXADPPJJPGLO-OLFWJLLRSA-N |
| XLogP | 6.32 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|