C21H18FN3O3S — CID 18874937
(2Z)-2-cyano-2-[5-[(2-fluorophenyl)methyl]-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-methylacetamide (PubChem CID 18874937) has the molecular formula C21H18FN3O3S and a molecular weight of 411.46 g/mol. Its IUPAC name is (2Z)-2-cyano-2-[5-[(2-fluorophenyl)methyl]-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-methylacetamide.
| Compound Name | (2Z)-2-cyano-2-[5-[(2-fluorophenyl)methyl]-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-methylacetamide |
|---|---|
| PubChem CID | 18874937 |
| Molecular Formula | C21H18FN3O3S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (2Z)-2-cyano-2-[5-[(2-fluorophenyl)methyl]-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-methylacetamide |
| SMILES | CNC(=O)/C(C#N)=C1\SC(Cc2ccccc2F)C(=O)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H18FN3O3S/c1-24-19(26)16(12-23)21-25(14-7-9-15(28-2)10-8-14)20(27)18(29-21)11-13-5-3-4-6-17(13)22/h3-10,18H,11H2,1-2H3,(H,24,26)/b21-16- |
| InChIKey | GXGJTOXSEBHXGK-PGMHBOJBSA-N |
| XLogP | 3.01 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|