C29H22F3N3O4S — CID 4871592
ethyl 4-[[2-cyano-2-[4-oxo-3-phenyl-5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-2-ylidene]acetyl]amino]benzoate (PubChem CID 4871592) has the molecular formula C29H22F3N3O4S and a molecular weight of 565.57 g/mol. Its IUPAC name is ethyl 4-[[2-cyano-2-[4-oxo-3-phenyl-5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-2-ylidene]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-cyano-2-[4-oxo-3-phenyl-5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-2-ylidene]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 4871592 |
| Molecular Formula | C29H22F3N3O4S |
| Molecular Weight | 565.57 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | ethyl 4-[[2-cyano-2-[4-oxo-3-phenyl-5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-2-ylidene]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(C#N)=C2SC(Cc3cccc(C(F)(F)F)c3)C(=O)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C29H22F3N3O4S/c1-2-39-28(38)19-11-13-21(14-12-19)34-25(36)23(17-33)27-35(22-9-4-3-5-10-22)26(37)24(40-27)16-18-7-6-8-20(15-18)29(30,31)32/h3-15,24H,2,16H2,1H3,(H,34,36) |
| InChIKey | OAUFOFXWQHPNLU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|