C25H15Cl4N3O2S — CID 4977383
2-cyano-N-(3,4-dichlorophenyl)-2-[5-[(3,4-dichlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide (PubChem CID 4977383) has the molecular formula C25H15Cl4N3O2S and a molecular weight of 563.29 g/mol. Its IUPAC name is 2-cyano-N-(3,4-dichlorophenyl)-2-[5-[(3,4-dichlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide.
| Compound Name | 2-cyano-N-(3,4-dichlorophenyl)-2-[5-[(3,4-dichlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 4977383 |
| Molecular Formula | C25H15Cl4N3O2S |
| Molecular Weight | 563.29 g/mol |
| Exact Mass | 560.96 |
| IUPAC Name | 2-cyano-N-(3,4-dichlorophenyl)-2-[5-[(3,4-dichlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide |
| SMILES | N#CC(C(=O)Nc1ccc(Cl)c(Cl)c1)=C1SC(Cc2ccc(Cl)c(Cl)c2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C25H15Cl4N3O2S/c26-18-8-6-14(10-20(18)28)11-22-24(34)32(16-4-2-1-3-5-16)25(35-22)17(13-30)23(33)31-15-7-9-19(27)21(29)12-15/h1-10,12,22H,11H2,(H,31,33) |
| InChIKey | NNXFYXBEKOYABQ-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.29 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|