C25H17ClFN3O2S — CID 41271944
(2Z)-2-[(5R)-5-[(4-chlorophenyl)methyl]-3-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-phenylacetamide (PubChem CID 41271944) has the molecular formula C25H17ClFN3O2S and a molecular weight of 477.95 g/mol. Its IUPAC name is (2Z)-2-[(5R)-5-[(4-chlorophenyl)methyl]-3-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-phenylacetamide.
| Compound Name | (2Z)-2-[(5R)-5-[(4-chlorophenyl)methyl]-3-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-phenylacetamide |
|---|---|
| PubChem CID | 41271944 |
| Molecular Formula | C25H17ClFN3O2S |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | (2Z)-2-[(5R)-5-[(4-chlorophenyl)methyl]-3-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-phenylacetamide |
| SMILES | N#C/C(C(=O)Nc1ccccc1)=C1/S[C@H](Cc2ccc(Cl)cc2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C25H17ClFN3O2S/c26-17-8-6-16(7-9-17)14-22-24(32)30(20-12-10-18(27)11-13-20)25(33-22)21(15-28)23(31)29-19-4-2-1-3-5-19/h1-13,22H,14H2,(H,29,31)/b25-21-/t22-/m1/s1 |
| InChIKey | IMMVMQAZWAOHQD-CKVBZJJFSA-N |
| XLogP | 5.54 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|