C25H15Cl3FN3O2S — CID 98184996
(2E)-2-[(5S)-3-(4-chlorophenyl)-5-[(2,5-dichlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(4-fluorophenyl)acetamide (PubChem CID 98184996) has the molecular formula C25H15Cl3FN3O2S and a molecular weight of 546.84 g/mol. Its IUPAC name is (2E)-2-[(5S)-3-(4-chlorophenyl)-5-[(2,5-dichlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(4-fluorophenyl)acetamide.
| Compound Name | (2E)-2-[(5S)-3-(4-chlorophenyl)-5-[(2,5-dichlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 98184996 |
| Molecular Formula | C25H15Cl3FN3O2S |
| Molecular Weight | 546.84 g/mol |
| Exact Mass | 544.99 |
| IUPAC Name | (2E)-2-[(5S)-3-(4-chlorophenyl)-5-[(2,5-dichlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(4-fluorophenyl)acetamide |
| SMILES | N#C/C(C(=O)Nc1ccc(F)cc1)=C1\S[C@@H](Cc2cc(Cl)ccc2Cl)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H15Cl3FN3O2S/c26-15-1-8-19(9-2-15)32-24(34)22(12-14-11-16(27)3-10-21(14)28)35-25(32)20(13-30)23(33)31-18-6-4-17(29)5-7-18/h1-11,22H,12H2,(H,31,33)/b25-20+/t22-/m0/s1 |
| InChIKey | ODMWGIGFRIUQDD-KVHSSYOWSA-N |
| XLogP | 6.85 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.84 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|