C25H17BrFN3O2S — CID 98158123
(2Z)-2-[(5S)-3-(4-bromophenyl)-5-[(4-fluorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-phenylacetamide (PubChem CID 98158123) has the molecular formula C25H17BrFN3O2S and a molecular weight of 522.40 g/mol. Its IUPAC name is (2Z)-2-[(5S)-3-(4-bromophenyl)-5-[(4-fluorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-phenylacetamide.
| Compound Name | (2Z)-2-[(5S)-3-(4-bromophenyl)-5-[(4-fluorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-phenylacetamide |
|---|---|
| PubChem CID | 98158123 |
| Molecular Formula | C25H17BrFN3O2S |
| Molecular Weight | 522.40 g/mol |
| Exact Mass | 521.02 |
| IUPAC Name | (2Z)-2-[(5S)-3-(4-bromophenyl)-5-[(4-fluorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-phenylacetamide |
| SMILES | N#C/C(C(=O)Nc1ccccc1)=C1/S[C@@H](Cc2ccc(F)cc2)C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H17BrFN3O2S/c26-17-8-12-20(13-9-17)30-24(32)22(14-16-6-10-18(27)11-7-16)33-25(30)21(15-28)23(31)29-19-4-2-1-3-5-19/h1-13,22H,14H2,(H,29,31)/b25-21-/t22-/m0/s1 |
| InChIKey | ZDSPKCAVXZRTKC-JSIHEXFSSA-N |
| XLogP | 5.65 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.40 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|