C26H19Br2N3O2S — CID 5044384
N-(4-bromophenyl)-2-[5-[(4-bromophenyl)methyl]-3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide (PubChem CID 5044384) has the molecular formula C26H19Br2N3O2S and a molecular weight of 597.33 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[5-[(4-bromophenyl)methyl]-3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide.
| Compound Name | N-(4-bromophenyl)-2-[5-[(4-bromophenyl)methyl]-3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide |
|---|---|
| PubChem CID | 5044384 |
| Molecular Formula | C26H19Br2N3O2S |
| Molecular Weight | 597.33 g/mol |
| Exact Mass | 594.96 |
| IUPAC Name | N-(4-bromophenyl)-2-[5-[(4-bromophenyl)methyl]-3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide |
| SMILES | Cc1ccc(N2C(=O)C(Cc3ccc(Br)cc3)SC2=C(C#N)C(=O)Nc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C26H19Br2N3O2S/c1-16-2-12-21(13-3-16)31-25(33)23(14-17-4-6-18(27)7-5-17)34-26(31)22(15-29)24(32)30-20-10-8-19(28)9-11-20/h2-13,23H,14H2,1H3,(H,30,32) |
| InChIKey | NHWYMNJKXSZNCU-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.33 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|