C26H19BrN4O4S — CID 3458575
N-(4-bromophenyl)-2-cyano-2-[3-(4-methylphenyl)-5-[(3-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetamide (PubChem CID 3458575) has the molecular formula C26H19BrN4O4S and a molecular weight of 563.43 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-cyano-2-[3-(4-methylphenyl)-5-[(3-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetamide.
| Compound Name | N-(4-bromophenyl)-2-cyano-2-[3-(4-methylphenyl)-5-[(3-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 3458575 |
| Molecular Formula | C26H19BrN4O4S |
| Molecular Weight | 563.43 g/mol |
| Exact Mass | 562.03 |
| IUPAC Name | N-(4-bromophenyl)-2-cyano-2-[3-(4-methylphenyl)-5-[(3-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetamide |
| SMILES | Cc1ccc(N2C(=O)C(Cc3cccc([N+](=O)[O-])c3)SC2=C(C#N)C(=O)Nc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C26H19BrN4O4S/c1-16-5-11-20(12-6-16)30-25(33)23(14-17-3-2-4-21(13-17)31(34)35)36-26(30)22(15-28)24(32)29-19-9-7-18(27)8-10-19/h2-13,23H,14H2,1H3,(H,29,32) |
| InChIKey | OHXIRQRKXZMVKX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.43 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|