C28H24N4O4S — CID 5449067
(2Z)-2-cyano-2-[(5S)-3-(4-methylphenyl)-5-[(3-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(2-phenylethyl)acetamide (PubChem CID 5449067) has the molecular formula C28H24N4O4S and a molecular weight of 512.59 g/mol. Its IUPAC name is (2Z)-2-cyano-2-[(5S)-3-(4-methylphenyl)-5-[(3-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(2-phenylethyl)acetamide.
| Compound Name | (2Z)-2-cyano-2-[(5S)-3-(4-methylphenyl)-5-[(3-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 5449067 |
| Molecular Formula | C28H24N4O4S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | (2Z)-2-cyano-2-[(5S)-3-(4-methylphenyl)-5-[(3-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(2-phenylethyl)acetamide |
| SMILES | Cc1ccc(N2C(=O)[C@H](Cc3cccc([N+](=O)[O-])c3)S/C2=C(/C#N)C(=O)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H24N4O4S/c1-19-10-12-22(13-11-19)31-27(34)25(17-21-8-5-9-23(16-21)32(35)36)37-28(31)24(18-29)26(33)30-15-14-20-6-3-2-4-7-20/h2-13,16,25H,14-15,17H2,1H3,(H,30,33)/b28-24-/t25-/m0/s1 |
| InChIKey | UVTNLLOFIJVDLL-UZEPBSNMSA-N |
| XLogP | 4.69 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|