C26H19FN4O4S — CID 3459232
2-cyano-2-[3-(4-fluorophenyl)-5-[(3-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(4-methylphenyl)acetamide (PubChem CID 3459232) has the molecular formula C26H19FN4O4S and a molecular weight of 502.53 g/mol. Its IUPAC name is 2-cyano-2-[3-(4-fluorophenyl)-5-[(3-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-cyano-2-[3-(4-fluorophenyl)-5-[(3-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 3459232 |
| Molecular Formula | C26H19FN4O4S |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 2-cyano-2-[3-(4-fluorophenyl)-5-[(3-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)C(C#N)=C2SC(Cc3cccc([N+](=O)[O-])c3)C(=O)N2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H19FN4O4S/c1-16-5-9-19(10-6-16)29-24(32)22(15-28)26-30(20-11-7-18(27)8-12-20)25(33)23(36-26)14-17-3-2-4-21(13-17)31(34)35/h2-13,23H,14H2,1H3,(H,29,32) |
| InChIKey | UNHYASKLQJXFGV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|