C31H31N3O2S — CID 41066928
(2E)-2-[(5S)-5-[(4-butylphenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2-phenylethyl)acetamide (PubChem CID 41066928) has the molecular formula C31H31N3O2S and a molecular weight of 509.68 g/mol. Its IUPAC name is (2E)-2-[(5S)-5-[(4-butylphenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2-phenylethyl)acetamide.
| Compound Name | (2E)-2-[(5S)-5-[(4-butylphenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 41066928 |
| Molecular Formula | C31H31N3O2S |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | (2E)-2-[(5S)-5-[(4-butylphenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2-phenylethyl)acetamide |
| SMILES | CCCCc1ccc(C[C@@H]2S/C(=C(\C#N)C(=O)NCCc3ccccc3)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C31H31N3O2S/c1-2-3-10-24-15-17-25(18-16-24)21-28-30(36)34(26-13-8-5-9-14-26)31(37-28)27(22-32)29(35)33-20-19-23-11-6-4-7-12-23/h4-9,11-18,28H,2-3,10,19-21H2,1H3,(H,33,35)/b31-27+/t28-/m0/s1 |
| InChIKey | KBTQMVAYQUBJLW-HONSFURUSA-N |
| XLogP | 5.81 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|