C30H29N3O2S — CID 42496956
(2Z)-2-[(5S)-5-[(4-butylphenyl)methyl]-3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-phenylacetamide (PubChem CID 42496956) has the molecular formula C30H29N3O2S and a molecular weight of 495.65 g/mol. Its IUPAC name is (2Z)-2-[(5S)-5-[(4-butylphenyl)methyl]-3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-phenylacetamide.
| Compound Name | (2Z)-2-[(5S)-5-[(4-butylphenyl)methyl]-3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-phenylacetamide |
|---|---|
| PubChem CID | 42496956 |
| Molecular Formula | C30H29N3O2S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | (2Z)-2-[(5S)-5-[(4-butylphenyl)methyl]-3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-phenylacetamide |
| SMILES | CCCCc1ccc(C[C@@H]2S/C(=C(/C#N)C(=O)Nc3ccccc3)N(c3ccccc3C)C2=O)cc1 |
| InChI | InChI=1S/C30H29N3O2S/c1-3-4-11-22-15-17-23(18-16-22)19-27-29(35)33(26-14-9-8-10-21(26)2)30(36-27)25(20-31)28(34)32-24-12-6-5-7-13-24/h5-10,12-18,27H,3-4,11,19H2,1-2H3,(H,32,34)/b30-25-/t27-/m0/s1 |
| InChIKey | FOGNDZAHBFTSMJ-SFJGOQPCSA-N |
| XLogP | 6.40 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|