C28H24ClN3O2S — CID 4310846
2-[5-[(3-chloro-4-methylphenyl)methyl]-3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2-methylphenyl)acetamide (PubChem CID 4310846) has the molecular formula C28H24ClN3O2S and a molecular weight of 502.04 g/mol. Its IUPAC name is 2-[5-[(3-chloro-4-methylphenyl)methyl]-3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[5-[(3-chloro-4-methylphenyl)methyl]-3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 4310846 |
| Molecular Formula | C28H24ClN3O2S |
| Molecular Weight | 502.04 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | 2-[5-[(3-chloro-4-methylphenyl)methyl]-3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccc(CC2SC(=C(C#N)C(=O)Nc3ccccc3C)N(c3ccccc3C)C2=O)cc1Cl |
| InChI | InChI=1S/C28H24ClN3O2S/c1-17-12-13-20(14-22(17)29)15-25-27(34)32(24-11-7-5-9-19(24)3)28(35-25)21(16-30)26(33)31-23-10-6-4-8-18(23)2/h4-14,25H,15H2,1-3H3,(H,31,33) |
| InChIKey | KMORUQHOFFOHIP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.04 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|