C28H23Cl2N3O2S — CID 18875588
(2Z)-2-cyano-2-[5-[(2,3-dichlorophenyl)methyl]-3-(4-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-(2-methylphenyl)acetamide (PubChem CID 18875588) has the molecular formula C28H23Cl2N3O2S and a molecular weight of 536.48 g/mol. Its IUPAC name is (2Z)-2-cyano-2-[5-[(2,3-dichlorophenyl)methyl]-3-(4-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-(2-methylphenyl)acetamide.
| Compound Name | (2Z)-2-cyano-2-[5-[(2,3-dichlorophenyl)methyl]-3-(4-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 18875588 |
| Molecular Formula | C28H23Cl2N3O2S |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | (2Z)-2-cyano-2-[5-[(2,3-dichlorophenyl)methyl]-3-(4-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-(2-methylphenyl)acetamide |
| SMILES | CCc1ccc(N2C(=O)C(Cc3cccc(Cl)c3Cl)S/C2=C(/C#N)C(=O)Nc2ccccc2C)cc1 |
| InChI | InChI=1S/C28H23Cl2N3O2S/c1-3-18-11-13-20(14-12-18)33-27(35)24(15-19-8-6-9-22(29)25(19)30)36-28(33)21(16-31)26(34)32-23-10-5-4-7-17(23)2/h4-14,24H,3,15H2,1-2H3,(H,32,34)/b28-21- |
| InChIKey | YZFQXDHHKBXBSX-HFTWOUSFSA-N |
| XLogP | 6.93 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|