C29H27N3O2S — CID 18875666
(2Z)-2-cyano-2-[3-(3,4-dimethylphenyl)-5-[(2-methylphenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(2-methylphenyl)acetamide (PubChem CID 18875666) has the molecular formula C29H27N3O2S and a molecular weight of 481.62 g/mol. Its IUPAC name is (2Z)-2-cyano-2-[3-(3,4-dimethylphenyl)-5-[(2-methylphenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(2-methylphenyl)acetamide.
| Compound Name | (2Z)-2-cyano-2-[3-(3,4-dimethylphenyl)-5-[(2-methylphenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 18875666 |
| Molecular Formula | C29H27N3O2S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | (2Z)-2-cyano-2-[3-(3,4-dimethylphenyl)-5-[(2-methylphenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccc(N2C(=O)C(Cc3ccccc3C)S/C2=C(/C#N)C(=O)Nc2ccccc2C)cc1C |
| InChI | InChI=1S/C29H27N3O2S/c1-18-13-14-23(15-21(18)4)32-28(34)26(16-22-11-7-5-9-19(22)2)35-29(32)24(17-30)27(33)31-25-12-8-6-10-20(25)3/h5-15,26H,16H2,1-4H3,(H,31,33)/b29-24- |
| InChIKey | LSLWAMLMACMWNW-OLFWJLLRSA-N |
| XLogP | 5.99 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|