C29H23ClF3N3O3S — CID 18876027
(2Z)-2-[5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2-methoxyphenyl)acetamide (PubChem CID 18876027) has the molecular formula C29H23ClF3N3O3S and a molecular weight of 586.04 g/mol. Its IUPAC name is (2Z)-2-[5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2-methoxyphenyl)acetamide.
| Compound Name | (2Z)-2-[5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 18876027 |
| Molecular Formula | C29H23ClF3N3O3S |
| Molecular Weight | 586.04 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | (2Z)-2-[5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)/C(C#N)=C1\SC(Cc2cc(C(F)(F)F)ccc2Cl)C(=O)N1c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C29H23ClF3N3O3S/c1-16-8-10-20(12-17(16)2)36-27(38)25(14-18-13-19(29(31,32)33)9-11-22(18)30)40-28(36)21(15-34)26(37)35-23-6-4-5-7-24(23)39-3/h4-13,25H,14H2,1-3H3,(H,35,37)/b28-21- |
| InChIKey | MIGWWEOJPMQOCB-HFTWOUSFSA-N |
| XLogP | 7.05 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.04 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|