C28H21ClF3N3O2S — CID 98158239
(2Z)-2-[(5S)-5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2-phenylethyl)acetamide (PubChem CID 98158239) has the molecular formula C28H21ClF3N3O2S and a molecular weight of 556.01 g/mol. Its IUPAC name is (2Z)-2-[(5S)-5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2-phenylethyl)acetamide.
| Compound Name | (2Z)-2-[(5S)-5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 98158239 |
| Molecular Formula | C28H21ClF3N3O2S |
| Molecular Weight | 556.01 g/mol |
| Exact Mass | 555.10 |
| IUPAC Name | (2Z)-2-[(5S)-5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2-phenylethyl)acetamide |
| SMILES | N#C/C(C(=O)NCCc1ccccc1)=C1/S[C@@H](Cc2cc(C(F)(F)F)ccc2Cl)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C28H21ClF3N3O2S/c29-23-12-11-20(28(30,31)32)15-19(23)16-24-26(37)35(21-9-5-2-6-10-21)27(38-24)22(17-33)25(36)34-14-13-18-7-3-1-4-8-18/h1-12,15,24H,13-14,16H2,(H,34,36)/b27-22-/t24-/m0/s1 |
| InChIKey | OAPAVDSQDUMUEQ-MZOFLMDJSA-N |
| XLogP | 6.14 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.01 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|