C26H18Cl3N3O2S — CID 6300681
(2Z)-N-benzyl-2-[3-(4-chlorophenyl)-5-[(2,4-dichlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide (PubChem CID 6300681) has the molecular formula C26H18Cl3N3O2S and a molecular weight of 542.88 g/mol. Its IUPAC name is (2Z)-N-benzyl-2-[3-(4-chlorophenyl)-5-[(2,4-dichlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide.
| Compound Name | (2Z)-N-benzyl-2-[3-(4-chlorophenyl)-5-[(2,4-dichlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide |
|---|---|
| PubChem CID | 6300681 |
| Molecular Formula | C26H18Cl3N3O2S |
| Molecular Weight | 542.88 g/mol |
| Exact Mass | 541.02 |
| IUPAC Name | (2Z)-N-benzyl-2-[3-(4-chlorophenyl)-5-[(2,4-dichlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide |
| SMILES | N#C/C(C(=O)NCc1ccccc1)=C1/SC(Cc2ccc(Cl)cc2Cl)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H18Cl3N3O2S/c27-18-8-10-20(11-9-18)32-25(34)23(12-17-6-7-19(28)13-22(17)29)35-26(32)21(14-30)24(33)31-15-16-4-2-1-3-5-16/h1-11,13,23H,12,15H2,(H,31,33)/b26-21- |
| InChIKey | DVXZWAZNHXJXBL-QLYXXIJNSA-N |
| XLogP | 6.39 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.88 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|