C26H20ClN3O2S — CID 3812004
N-benzyl-2-[5-[(4-chlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide (PubChem CID 3812004) has the molecular formula C26H20ClN3O2S and a molecular weight of 473.99 g/mol. Its IUPAC name is N-benzyl-2-[5-[(4-chlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide.
| Compound Name | N-benzyl-2-[5-[(4-chlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide |
|---|---|
| PubChem CID | 3812004 |
| Molecular Formula | C26H20ClN3O2S |
| Molecular Weight | 473.99 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | N-benzyl-2-[5-[(4-chlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide |
| SMILES | N#CC(C(=O)NCc1ccccc1)=C1SC(Cc2ccc(Cl)cc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C26H20ClN3O2S/c27-20-13-11-18(12-14-20)15-23-25(32)30(21-9-5-2-6-10-21)26(33-23)22(16-28)24(31)29-17-19-7-3-1-4-8-19/h1-14,23H,15,17H2,(H,29,31) |
| InChIKey | DNTAOGUSSXZDSR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.99 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|