C33H35N3O2S — CID 18875028
(2Z)-N-benzyl-2-[5-[(4-butylphenyl)methyl]-4-oxo-3-(4-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide (PubChem CID 18875028) has the molecular formula C33H35N3O2S and a molecular weight of 537.73 g/mol. Its IUPAC name is (2Z)-N-benzyl-2-[5-[(4-butylphenyl)methyl]-4-oxo-3-(4-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide.
| Compound Name | (2Z)-N-benzyl-2-[5-[(4-butylphenyl)methyl]-4-oxo-3-(4-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide |
|---|---|
| PubChem CID | 18875028 |
| Molecular Formula | C33H35N3O2S |
| Molecular Weight | 537.73 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | (2Z)-N-benzyl-2-[5-[(4-butylphenyl)methyl]-4-oxo-3-(4-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide |
| SMILES | CCCCc1ccc(CC2S/C(=C(/C#N)C(=O)NCc3ccccc3)N(c3ccc(C(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C33H35N3O2S/c1-4-5-9-24-12-14-25(15-13-24)20-30-32(38)36(28-18-16-27(17-19-28)23(2)3)33(39-30)29(21-34)31(37)35-22-26-10-7-6-8-11-26/h6-8,10-19,23,30H,4-5,9,20,22H2,1-3H3,(H,35,37)/b33-29- |
| InChIKey | RZJIVQDZKBIWNM-IYOYZZHUSA-N |
| XLogP | 6.90 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.73 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|