C27H22ClN3O2S — CID 5195850
2-[5-[(2-chlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2,6-dimethylphenyl)acetamide (PubChem CID 5195850) has the molecular formula C27H22ClN3O2S and a molecular weight of 488.01 g/mol. Its IUPAC name is 2-[5-[(2-chlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[5-[(2-chlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 5195850 |
| Molecular Formula | C27H22ClN3O2S |
| Molecular Weight | 488.01 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 2-[5-[(2-chlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyano-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(C#N)=C1SC(Cc2ccccc2Cl)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C27H22ClN3O2S/c1-17-9-8-10-18(2)24(17)30-25(32)21(16-29)27-31(20-12-4-3-5-13-20)26(33)23(34-27)15-19-11-6-7-14-22(19)28/h3-14,23H,15H2,1-2H3,(H,30,32) |
| InChIKey | FVALOFSEFLAQMT-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.01 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|