C29H26ClN3O2S — CID 40927336
(2E)-N-(4-butylphenyl)-2-[(5R)-5-[(3-chlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide (PubChem CID 40927336) has the molecular formula C29H26ClN3O2S and a molecular weight of 516.07 g/mol. Its IUPAC name is (2E)-N-(4-butylphenyl)-2-[(5R)-5-[(3-chlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide.
| Compound Name | (2E)-N-(4-butylphenyl)-2-[(5R)-5-[(3-chlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide |
|---|---|
| PubChem CID | 40927336 |
| Molecular Formula | C29H26ClN3O2S |
| Molecular Weight | 516.07 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | (2E)-N-(4-butylphenyl)-2-[(5R)-5-[(3-chlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide |
| SMILES | CCCCc1ccc(NC(=O)/C(C#N)=C2/S[C@H](Cc3cccc(Cl)c3)C(=O)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C29H26ClN3O2S/c1-2-3-8-20-13-15-23(16-14-20)32-27(34)25(19-31)29-33(24-11-5-4-6-12-24)28(35)26(36-29)18-21-9-7-10-22(30)17-21/h4-7,9-17,26H,2-3,8,18H2,1H3,(H,32,34)/b29-25+/t26-/m1/s1 |
| InChIKey | ONQDQCVABYAXLX-VOUPIIBTSA-N |
| XLogP | 6.75 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.07 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|