C25H16Cl3N3O2S — CID 6141040
(2Z)-N-(3-chlorophenyl)-2-cyano-2-[5-[(3,4-dichlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide (PubChem CID 6141040) has the molecular formula C25H16Cl3N3O2S and a molecular weight of 528.85 g/mol. Its IUPAC name is (2Z)-N-(3-chlorophenyl)-2-cyano-2-[5-[(3,4-dichlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide.
| Compound Name | (2Z)-N-(3-chlorophenyl)-2-cyano-2-[5-[(3,4-dichlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 6141040 |
| Molecular Formula | C25H16Cl3N3O2S |
| Molecular Weight | 528.85 g/mol |
| Exact Mass | 527.00 |
| IUPAC Name | (2Z)-N-(3-chlorophenyl)-2-cyano-2-[5-[(3,4-dichlorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide |
| SMILES | N#C/C(C(=O)Nc1cccc(Cl)c1)=C1/SC(Cc2ccc(Cl)c(Cl)c2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C25H16Cl3N3O2S/c26-16-5-4-6-17(13-16)30-23(32)19(14-29)25-31(18-7-2-1-3-8-18)24(33)22(34-25)12-15-9-10-20(27)21(28)11-15/h1-11,13,22H,12H2,(H,30,32)/b25-19- |
| InChIKey | JBJMIZBJOBUGMB-PLRJNAJWSA-N |
| XLogP | 6.71 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.85 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|