C30H31N3O3S — CID 18875235
(2Z)-2-[5-[(4-butylphenyl)methyl]-3-(4-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(furan-2-ylmethyl)acetamide (PubChem CID 18875235) has the molecular formula C30H31N3O3S and a molecular weight of 513.66 g/mol. Its IUPAC name is (2Z)-2-[5-[(4-butylphenyl)methyl]-3-(4-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(furan-2-ylmethyl)acetamide.
| Compound Name | (2Z)-2-[5-[(4-butylphenyl)methyl]-3-(4-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 18875235 |
| Molecular Formula | C30H31N3O3S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | (2Z)-2-[5-[(4-butylphenyl)methyl]-3-(4-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(furan-2-ylmethyl)acetamide |
| SMILES | CCCCc1ccc(CC2S/C(=C(/C#N)C(=O)NCc3ccco3)N(c3ccc(CC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C30H31N3O3S/c1-3-5-7-22-9-11-23(12-10-22)18-27-29(35)33(24-15-13-21(4-2)14-16-24)30(37-27)26(19-31)28(34)32-20-25-8-6-17-36-25/h6,8-17,27H,3-5,7,18,20H2,1-2H3,(H,32,34)/b30-26- |
| InChIKey | FCANZKAJJZQTOU-BXVZCJGGSA-N |
| XLogP | 5.93 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|