C24H18FN3O3S — CID 3770911
2-cyano-2-[5-[(4-fluorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-N-(furan-2-ylmethyl)acetamide (PubChem CID 3770911) has the molecular formula C24H18FN3O3S and a molecular weight of 447.49 g/mol. Its IUPAC name is 2-cyano-2-[5-[(4-fluorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-cyano-2-[5-[(4-fluorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3770911 |
| Molecular Formula | C24H18FN3O3S |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 2-cyano-2-[5-[(4-fluorophenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-N-(furan-2-ylmethyl)acetamide |
| SMILES | N#CC(C(=O)NCc1ccco1)=C1SC(Cc2ccc(F)cc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C24H18FN3O3S/c25-17-10-8-16(9-11-17)13-21-23(30)28(18-5-2-1-3-6-18)24(32-21)20(14-26)22(29)27-15-19-7-4-12-31-19/h1-12,21H,13,15H2,(H,27,29) |
| InChIKey | YKJYEZBLLVFZOW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|