C25H20FN3O3S — CID 3636433
2-cyano-2-[3-(4-fluorophenyl)-5-[(3-methylphenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(furan-2-ylmethyl)acetamide (PubChem CID 3636433) has the molecular formula C25H20FN3O3S and a molecular weight of 461.52 g/mol. Its IUPAC name is 2-cyano-2-[3-(4-fluorophenyl)-5-[(3-methylphenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-cyano-2-[3-(4-fluorophenyl)-5-[(3-methylphenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3636433 |
| Molecular Formula | C25H20FN3O3S |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 2-cyano-2-[3-(4-fluorophenyl)-5-[(3-methylphenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(furan-2-ylmethyl)acetamide |
| SMILES | Cc1cccc(CC2SC(=C(C#N)C(=O)NCc3ccco3)N(c3ccc(F)cc3)C2=O)c1 |
| InChI | InChI=1S/C25H20FN3O3S/c1-16-4-2-5-17(12-16)13-22-24(31)29(19-9-7-18(26)8-10-19)25(33-22)21(14-27)23(30)28-15-20-6-3-11-32-20/h2-12,22H,13,15H2,1H3,(H,28,30) |
| InChIKey | YUTDUNGJDPVDJC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|