C28H22FN3O4S — CID 3695446
ethyl 4-[[2-[1-cyano-2-(4-fluoroanilino)-2-oxoethylidene]-4-oxo-3-phenyl-1,3-thiazolidin-5-yl]methyl]benzoate (PubChem CID 3695446) has the molecular formula C28H22FN3O4S and a molecular weight of 515.57 g/mol. Its IUPAC name is ethyl 4-[[2-[1-cyano-2-(4-fluoroanilino)-2-oxoethylidene]-4-oxo-3-phenyl-1,3-thiazolidin-5-yl]methyl]benzoate.
| Compound Name | ethyl 4-[[2-[1-cyano-2-(4-fluoroanilino)-2-oxoethylidene]-4-oxo-3-phenyl-1,3-thiazolidin-5-yl]methyl]benzoate |
|---|---|
| PubChem CID | 3695446 |
| Molecular Formula | C28H22FN3O4S |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | ethyl 4-[[2-[1-cyano-2-(4-fluoroanilino)-2-oxoethylidene]-4-oxo-3-phenyl-1,3-thiazolidin-5-yl]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CC2SC(=C(C#N)C(=O)Nc3ccc(F)cc3)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C28H22FN3O4S/c1-2-36-28(35)19-10-8-18(9-11-19)16-24-26(34)32(22-6-4-3-5-7-22)27(37-24)23(17-30)25(33)31-21-14-12-20(29)13-15-21/h3-15,24H,2,16H2,1H3,(H,31,33) |
| InChIKey | UDDHMWCONQOTFZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|