C27H22ClN3O3S — CID 18875744
(2Z)-2-[5-[(3-chlorophenyl)methyl]-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(3-methylphenyl)acetamide (PubChem CID 18875744) has the molecular formula C27H22ClN3O3S and a molecular weight of 504.01 g/mol. Its IUPAC name is (2Z)-2-[5-[(3-chlorophenyl)methyl]-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(3-methylphenyl)acetamide.
| Compound Name | (2Z)-2-[5-[(3-chlorophenyl)methyl]-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 18875744 |
| Molecular Formula | C27H22ClN3O3S |
| Molecular Weight | 504.01 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | (2Z)-2-[5-[(3-chlorophenyl)methyl]-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(3-methylphenyl)acetamide |
| SMILES | COc1ccc(N2C(=O)C(Cc3cccc(Cl)c3)S/C2=C(/C#N)C(=O)Nc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C27H22ClN3O3S/c1-17-5-3-8-20(13-17)30-25(32)23(16-29)27-31(21-9-11-22(34-2)12-10-21)26(33)24(35-27)15-18-6-4-7-19(28)14-18/h3-14,24H,15H2,1-2H3,(H,30,32)/b27-23- |
| InChIKey | SYSWMADOUUUSKF-VYIQYICTSA-N |
| XLogP | 5.72 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.01 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|