C22H17BrN2O3 — CID 146473412
11-[(3-bromophenyl)methyl]-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione (PubChem CID 146473412) has the molecular formula C22H17BrN2O3 and a molecular weight of 437.29 g/mol. Its IUPAC name is 11-[(3-bromophenyl)methyl]-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione.
| Compound Name | 11-[(3-bromophenyl)methyl]-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
|---|---|
| PubChem CID | 146473412 |
| Molecular Formula | C22H17BrN2O3 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 11-[(3-bromophenyl)methyl]-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
| SMILES | O=C1C=CC2C3C(=O)N(c4ccccc4)C(=O)C3C1N2Cc1cccc(Br)c1 |
| InChI | InChI=1S/C22H17BrN2O3/c23-14-6-4-5-13(11-14)12-24-16-9-10-17(26)20(24)19-18(16)21(27)25(22(19)28)15-7-2-1-3-8-15/h1-11,16,18-20H,12H2 |
| InChIKey | PUWQTBNHLAGJFK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|