C27H27N3O4 — CID 145259086
(2R)-11-[(3-methylphenyl)methyl]-4-(3-morpholin-4-ylphenyl)-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione (PubChem CID 145259086) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is (2R)-11-[(3-methylphenyl)methyl]-4-(3-morpholin-4-ylphenyl)-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione.
| Compound Name | (2R)-11-[(3-methylphenyl)methyl]-4-(3-morpholin-4-ylphenyl)-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
|---|---|
| PubChem CID | 145259086 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | (2R)-11-[(3-methylphenyl)methyl]-4-(3-morpholin-4-ylphenyl)-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
| SMILES | Cc1cccc(CN2C3C(=O)C=CC2[C@@H]2C(=O)N(c4cccc(N5CCOCC5)c4)C(=O)C32)c1 |
| InChI | InChI=1S/C27H27N3O4/c1-17-4-2-5-18(14-17)16-29-21-8-9-22(31)25(29)24-23(21)26(32)30(27(24)33)20-7-3-6-19(15-20)28-10-12-34-13-11-28/h2-9,14-15,21,23-25H,10-13,16H2,1H3/t21?,23-,24?,25?/m0/s1 |
| InChIKey | IOKCAHCZUMEMMR-FXQQDQFQSA-N |
| XLogP | 2.33 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|