C20H22BrN3O — CID 86687819
4-[7-bromo-2-methyl-3-[(3-methylphenyl)methyl]benzimidazol-5-yl]morpholine (PubChem CID 86687819) has the molecular formula C20H22BrN3O and a molecular weight of 400.32 g/mol. Its IUPAC name is 4-[7-bromo-2-methyl-3-[(3-methylphenyl)methyl]benzimidazol-5-yl]morpholine.
| Compound Name | 4-[7-bromo-2-methyl-3-[(3-methylphenyl)methyl]benzimidazol-5-yl]morpholine |
|---|---|
| PubChem CID | 86687819 |
| Molecular Formula | C20H22BrN3O |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 4-[7-bromo-2-methyl-3-[(3-methylphenyl)methyl]benzimidazol-5-yl]morpholine |
| SMILES | Cc1cccc(Cn2c(C)nc3c(Br)cc(N4CCOCC4)cc32)c1 |
| InChI | InChI=1S/C20H22BrN3O/c1-14-4-3-5-16(10-14)13-24-15(2)22-20-18(21)11-17(12-19(20)24)23-6-8-25-9-7-23/h3-5,10-12H,6-9,13H2,1-2H3 |
| InChIKey | PDLSEZFPKIFURP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |