C44H52N4O8 — CID 100991495
4,10,16,22-tetrakis(3-methylphenyl)-1,7,13,19-tetraoxa-4,10,16,22-tetrazacyclotetracosane-3,11,15,23-tetrone (PubChem CID 100991495) has the molecular formula C44H52N4O8 and a molecular weight of 764.92 g/mol. Its IUPAC name is 4,10,16,22-tetrakis(3-methylphenyl)-1,7,13,19-tetraoxa-4,10,16,22-tetrazacyclotetracosane-3,11,15,23-tetrone.
| Compound Name | 4,10,16,22-tetrakis(3-methylphenyl)-1,7,13,19-tetraoxa-4,10,16,22-tetrazacyclotetracosane-3,11,15,23-tetrone |
|---|---|
| PubChem CID | 100991495 |
| Molecular Formula | C44H52N4O8 |
| Molecular Weight | 764.92 g/mol |
| Exact Mass | 764.38 |
| IUPAC Name | 4,10,16,22-tetrakis(3-methylphenyl)-1,7,13,19-tetraoxa-4,10,16,22-tetrazacyclotetracosane-3,11,15,23-tetrone |
| SMILES | Cc1cccc(N2CCOCCN(c3cccc(C)c3)C(=O)COCC(=O)N(c3cccc(C)c3)CCOCCN(c3cccc(C)c3)C(=O)COCC2=O)c1 |
| InChI | InChI=1S/C44H52N4O8/c1-33-9-5-13-37(25-33)45-17-21-53-22-18-46(38-14-6-10-34(2)26-38)43(51)31-56-32-44(52)48(40-16-8-12-36(4)28-40)20-24-54-23-19-47(39-15-7-11-35(3)27-39)42(50)30-55-29-41(45)49/h5-16,25-28H,17-24,29-32H2,1-4H3 |
| InChIKey | VFAOILMETSPKAQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 118.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.92 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |