C18H24N2O5 — CID 167909828
[(2S)-2-morpholin-4-ylpropyl] 3-(3-oxomorpholin-4-yl)benzoate (PubChem CID 167909828) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is [(2S)-2-morpholin-4-ylpropyl] 3-(3-oxomorpholin-4-yl)benzoate.
| Compound Name | [(2S)-2-morpholin-4-ylpropyl] 3-(3-oxomorpholin-4-yl)benzoate |
|---|---|
| PubChem CID | 167909828 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | [(2S)-2-morpholin-4-ylpropyl] 3-(3-oxomorpholin-4-yl)benzoate |
| SMILES | C[C@@H](COC(=O)c1cccc(N2CCOCC2=O)c1)N1CCOCC1 |
| InChI | InChI=1S/C18H24N2O5/c1-14(19-5-8-23-9-6-19)12-25-18(22)15-3-2-4-16(11-15)20-7-10-24-13-17(20)21/h2-4,11,14H,5-10,12-13H2,1H3/t14-/m0/s1 |
| InChIKey | CDTUMPNMQZHAFU-AWEZNQCLSA-N |
| XLogP | 0.93 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |