About 2-morpholin-4-ylpropyl 2-methylpropanoate
2-morpholin-4-ylpropyl 2-methylpropanoate (PubChem CID 131966450) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is 2-morpholin-4-ylpropyl 2-methylpropanoate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylpropyl 2-methylpropanoate |
| PubChem CID | 131966450 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 2-morpholin-4-ylpropyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCC(C)N1CCOCC1 |
| InChI | InChI=1S/C11H21NO3/c1-9(2)11(13)15-8-10(3)12-4-6-14-7-5-12/h9-10H,4-8H2,1-3H3 |
| InChIKey | SAIQSPDXNGBGAK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-morpholin-4-ylpropyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylpropyl 2-methylpropanoate?
The IUPAC name of 2-morpholin-4-ylpropyl 2-methylpropanoate (CID 131966450) is 2-morpholin-4-ylpropyl 2-methylpropanoate.
What is the SMILES notation for 2-morpholin-4-ylpropyl 2-methylpropanoate?
The canonical SMILES for 2-morpholin-4-ylpropyl 2-methylpropanoate is CC(C)C(=O)OCC(C)N1CCOCC1.
What is the InChIKey of 2-morpholin-4-ylpropyl 2-methylpropanoate?
The InChIKey is SAIQSPDXNGBGAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-9(2)11(13)15-8-10(3)12-4-6-14-7-5-12/h9-10H,4-8H2,1-3H3.
What are the key properties of 2-morpholin-4-ylpropyl 2-methylpropanoate?
2-morpholin-4-ylpropyl 2-methylpropanoate has a molecular weight of 215.29 g/mol, XLogP of 0.91, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylpropyl 2-methylpropanoate is sourced from PubChem (CID 131966450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).