About 2-morpholin-4-ylpropyl prop-2-enoate;propyl 2-morpholin-4-ylprop-2-enoate
2-morpholin-4-ylpropyl prop-2-enoate;propyl 2-morpholin-4-ylprop-2-enoate (PubChem CID 146541159) has the molecular formula C20H34N2O6
and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-morpholin-4-ylpropyl prop-2-enoate;propyl 2-morpholin-4-ylprop-2-enoate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylpropyl prop-2-enoate;propyl 2-morpholin-4-ylprop-2-enoate |
| PubChem CID | 146541159 |
| Molecular Formula | C20H34N2O6 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 2-morpholin-4-ylpropyl prop-2-enoate;propyl 2-morpholin-4-ylprop-2-enoate |
| SMILES | C=C(C(=O)OCCC)N1CCOCC1.C=CC(=O)OCC(C)N1CCOCC1 |
| InChI | InChI=1S/2C10H17NO3/c1-3-10(12)14-8-9(2)11-4-6-13-7-5-11;1-3-6-14-10(12)9(2)11-4-7-13-8-5-11/h3,9H,1,4-8H2,2H3;2-8H2,1H3 |
| InChIKey | PEKNLDCFOXOKOY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-4-ylpropyl prop-2-enoate;propyl 2-morpholin-4-ylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylpropyl prop-2-enoate;propyl 2-morpholin-4-ylprop-2-enoate?
The IUPAC name of 2-morpholin-4-ylpropyl prop-2-enoate;propyl 2-morpholin-4-ylprop-2-enoate (CID 146541159) is 2-morpholin-4-ylpropyl prop-2-enoate;propyl 2-morpholin-4-ylprop-2-enoate.
What is the SMILES notation for 2-morpholin-4-ylpropyl prop-2-enoate;propyl 2-morpholin-4-ylprop-2-enoate?
The canonical SMILES for 2-morpholin-4-ylpropyl prop-2-enoate;propyl 2-morpholin-4-ylprop-2-enoate is C=C(C(=O)OCCC)N1CCOCC1.C=CC(=O)OCC(C)N1CCOCC1.
What is the InChIKey of 2-morpholin-4-ylpropyl prop-2-enoate;propyl 2-morpholin-4-ylprop-2-enoate?
The InChIKey is PEKNLDCFOXOKOY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H17NO3/c1-3-10(12)14-8-9(2)11-4-6-13-7-5-11;1-3-6-14-10(12)9(2)11-4-7-13-8-5-11/h3,9H,1,4-8H2,2H3;2-8H2,1H3.
What are the key properties of 2-morpholin-4-ylpropyl prop-2-enoate;propyl 2-morpholin-4-ylprop-2-enoate?
2-morpholin-4-ylpropyl prop-2-enoate;propyl 2-morpholin-4-ylprop-2-enoate has a molecular weight of 398.50 g/mol, XLogP of 1.22, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylpropyl prop-2-enoate;propyl 2-morpholin-4-ylprop-2-enoate is sourced from PubChem (CID 146541159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).