C15H31NO2 — CID 146373089
N,N-di(propan-2-yl)propan-2-amine;propyl prop-2-enoate (PubChem CID 146373089) has the molecular formula C15H31NO2 and a molecular weight of 257.42 g/mol. Its IUPAC name is N,N-di(propan-2-yl)propan-2-amine;propyl prop-2-enoate.
| Compound Name | N,N-di(propan-2-yl)propan-2-amine;propyl prop-2-enoate |
|---|---|
| PubChem CID | 146373089 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | N,N-di(propan-2-yl)propan-2-amine;propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC.CC(C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C9H21N.C6H10O2/c1-7(2)10(8(3)4)9(5)6;1-3-5-8-6(7)4-2/h7-9H,1-6H3;4H,2-3,5H2,1H3 |
| InChIKey | VGOGULMMIADEFZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|