About 4-(dimethylamino)pentyl prop-2-enoate
4-(dimethylamino)pentyl prop-2-enoate (PubChem CID 159489055) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is 4-(dimethylamino)pentyl prop-2-enoate.
Molecular Properties
| Compound Name | 4-(dimethylamino)pentyl prop-2-enoate |
| PubChem CID | 159489055 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 4-(dimethylamino)pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCC(C)N(C)C |
| InChI | InChI=1S/C10H19NO2/c1-5-10(12)13-8-6-7-9(2)11(3)4/h5,9H,1,6-8H2,2-4H3 |
| InChIKey | FBVPZWACMNWHTF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)pentyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)pentyl prop-2-enoate?
The IUPAC name of 4-(dimethylamino)pentyl prop-2-enoate (CID 159489055) is 4-(dimethylamino)pentyl prop-2-enoate.
What is the SMILES notation for 4-(dimethylamino)pentyl prop-2-enoate?
The canonical SMILES for 4-(dimethylamino)pentyl prop-2-enoate is C=CC(=O)OCCCC(C)N(C)C.
What is the InChIKey of 4-(dimethylamino)pentyl prop-2-enoate?
The InChIKey is FBVPZWACMNWHTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-5-10(12)13-8-6-7-9(2)11(3)4/h5,9H,1,6-8H2,2-4H3.
What are the key properties of 4-(dimethylamino)pentyl prop-2-enoate?
4-(dimethylamino)pentyl prop-2-enoate has a molecular weight of 185.27 g/mol, XLogP of 1.45, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)pentyl prop-2-enoate is sourced from PubChem (CID 159489055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).