About bis[3-(dimethylamino)butyl] (E)-but-2-enedioate;hydrochloride
bis[3-(dimethylamino)butyl] (E)-but-2-enedioate;hydrochloride (PubChem CID 175016414) has the molecular formula C16H31ClN2O4
and a molecular weight of 350.89 g/mol. Its IUPAC name is bis[3-(dimethylamino)butyl] (E)-but-2-enedioate;hydrochloride.
Molecular Properties
| Compound Name | bis[3-(dimethylamino)butyl] (E)-but-2-enedioate;hydrochloride |
| PubChem CID | 175016414 |
| Molecular Formula | C16H31ClN2O4 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | bis[3-(dimethylamino)butyl] (E)-but-2-enedioate;hydrochloride |
| SMILES | CC(CCOC(=O)/C=C/C(=O)OCCC(C)N(C)C)N(C)C.Cl |
| InChI | InChI=1S/C16H30N2O4.ClH/c1-13(17(3)4)9-11-21-15(19)7-8-16(20)22-12-10-14(2)18(5)6;/h7-8,13-14H,9-12H2,1-6H3;1H/b8-7+; |
| InChIKey | PRUFSADMNMSEDW-USRGLUTNSA-N |
| XLogP | 1.73 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis[3-(dimethylamino)butyl] (E)-but-2-enedioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-(dimethylamino)butyl] (E)-but-2-enedioate;hydrochloride?
The IUPAC name of bis[3-(dimethylamino)butyl] (E)-but-2-enedioate;hydrochloride (CID 175016414) is bis[3-(dimethylamino)butyl] (E)-but-2-enedioate;hydrochloride.
What is the SMILES notation for bis[3-(dimethylamino)butyl] (E)-but-2-enedioate;hydrochloride?
The canonical SMILES for bis[3-(dimethylamino)butyl] (E)-but-2-enedioate;hydrochloride is CC(CCOC(=O)/C=C/C(=O)OCCC(C)N(C)C)N(C)C.Cl.
What is the InChIKey of bis[3-(dimethylamino)butyl] (E)-but-2-enedioate;hydrochloride?
The InChIKey is PRUFSADMNMSEDW-USRGLUTNSA-N. The full InChI is InChI=1S/C16H30N2O4.ClH/c1-13(17(3)4)9-11-21-15(19)7-8-16(20)22-12-10-14(2)18(5)6;/h7-8,13-14H,9-12H2,1-6H3;1H/b8-7+;.
What are the key properties of bis[3-(dimethylamino)butyl] (E)-but-2-enedioate;hydrochloride?
bis[3-(dimethylamino)butyl] (E)-but-2-enedioate;hydrochloride has a molecular weight of 350.89 g/mol, XLogP of 1.73, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-(dimethylamino)butyl] (E)-but-2-enedioate;hydrochloride is sourced from PubChem (CID 175016414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).