About dimethoxy(propyl)silane;propyl prop-2-enoate
dimethoxy(propyl)silane;propyl prop-2-enoate (PubChem CID 174852514) has the molecular formula C11H24O4Si
and a molecular weight of 248.39 g/mol. Its IUPAC name is dimethoxy(propyl)silane;propyl prop-2-enoate.
Molecular Properties
| Compound Name | dimethoxy(propyl)silane;propyl prop-2-enoate |
| PubChem CID | 174852514 |
| Molecular Formula | C11H24O4Si |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | dimethoxy(propyl)silane;propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC.CCC[SiH](OC)OC |
| InChI | InChI=1S/C6H10O2.C5H14O2Si/c1-3-5-8-6(7)4-2;1-4-5-8(6-2)7-3/h4H,2-3,5H2,1H3;8H,4-5H2,1-3H3 |
| InChIKey | DLMKUDZQMBHEDF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy(propyl)silane;propyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy(propyl)silane;propyl prop-2-enoate?
The IUPAC name of dimethoxy(propyl)silane;propyl prop-2-enoate (CID 174852514) is dimethoxy(propyl)silane;propyl prop-2-enoate.
What is the SMILES notation for dimethoxy(propyl)silane;propyl prop-2-enoate?
The canonical SMILES for dimethoxy(propyl)silane;propyl prop-2-enoate is C=CC(=O)OCCC.CCC[SiH](OC)OC.
What is the InChIKey of dimethoxy(propyl)silane;propyl prop-2-enoate?
The InChIKey is DLMKUDZQMBHEDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C5H14O2Si/c1-3-5-8-6(7)4-2;1-4-5-8(6-2)7-3/h4H,2-3,5H2,1H3;8H,4-5H2,1-3H3.
What are the key properties of dimethoxy(propyl)silane;propyl prop-2-enoate?
dimethoxy(propyl)silane;propyl prop-2-enoate has a molecular weight of 248.39 g/mol, XLogP of 2.04, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy(propyl)silane;propyl prop-2-enoate is sourced from PubChem (CID 174852514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).