C17H18N2O6 — CID 7204669
(2-morpholin-4-yl-2-oxoethyl) 3-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 7204669) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) 3-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 7204669 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(OCC(=O)N1CCOCC1)c1cccc(N2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C17H18N2O6/c20-14-4-5-15(21)19(14)13-3-1-2-12(10-13)17(23)25-11-16(22)18-6-8-24-9-7-18/h1-3,10H,4-9,11H2 |
| InChIKey | PVCWEMGAHNWXQI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|