C15H19NO6S — CID 8836549
(2-morpholin-4-yl-2-oxoethyl) 3-(methylsulfonylmethyl)benzoate (PubChem CID 8836549) has the molecular formula C15H19NO6S and a molecular weight of 341.38 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) 3-(methylsulfonylmethyl)benzoate.
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) 3-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 8836549 |
| Molecular Formula | C15H19NO6S |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) 3-(methylsulfonylmethyl)benzoate |
| SMILES | CS(=O)(=O)Cc1cccc(C(=O)OCC(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C15H19NO6S/c1-23(19,20)11-12-3-2-4-13(9-12)15(18)22-10-14(17)16-5-7-21-8-6-16/h2-4,9H,5-8,10-11H2,1H3 |
| InChIKey | CYVGAPJLOLROOL-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |