C15H20O5S — CID 94871804
[(2S)-oxan-2-yl]methyl 3-(methylsulfonylmethyl)benzoate (PubChem CID 94871804) has the molecular formula C15H20O5S and a molecular weight of 312.39 g/mol. Its IUPAC name is [(2S)-oxan-2-yl]methyl 3-(methylsulfonylmethyl)benzoate.
| Compound Name | [(2S)-oxan-2-yl]methyl 3-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 94871804 |
| Molecular Formula | C15H20O5S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | [(2S)-oxan-2-yl]methyl 3-(methylsulfonylmethyl)benzoate |
| SMILES | CS(=O)(=O)Cc1cccc(C(=O)OC[C@@H]2CCCCO2)c1 |
| InChI | InChI=1S/C15H20O5S/c1-21(17,18)11-12-5-4-6-13(9-12)15(16)20-10-14-7-2-3-8-19-14/h4-6,9,14H,2-3,7-8,10-11H2,1H3/t14-/m0/s1 |
| InChIKey | LVJBCIGMCXKFOI-AWEZNQCLSA-N |
| XLogP | 1.96 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |