C23H32O10S — CID 59918016
1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl 3-(4-hydroxybut-2-ynylsulfonylmethyl)benzoate (PubChem CID 59918016) has the molecular formula C23H32O10S and a molecular weight of 500.57 g/mol. Its IUPAC name is 1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl 3-(4-hydroxybut-2-ynylsulfonylmethyl)benzoate.
| Compound Name | 1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl 3-(4-hydroxybut-2-ynylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 59918016 |
| Molecular Formula | C23H32O10S |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | 1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl 3-(4-hydroxybut-2-ynylsulfonylmethyl)benzoate |
| SMILES | O=C(OCC1COCCOCCOCCOCCO1)c1cccc(CS(=O)(=O)CC#CCO)c1 |
| InChI | InChI=1S/C23H32O10S/c24-6-1-2-15-34(26,27)19-20-4-3-5-21(16-20)23(25)33-18-22-17-31-12-11-29-8-7-28-9-10-30-13-14-32-22/h3-5,16,22,24H,6-15,17-19H2 |
| InChIKey | VFMJMFXXIKCHMX-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|