About oxan-4-ylmethyl 3-(aminomethyl)benzoate
oxan-4-ylmethyl 3-(aminomethyl)benzoate (PubChem CID 62384374) has the molecular formula C14H19NO3
and a molecular weight of 249.31 g/mol. Its IUPAC name is oxan-4-ylmethyl 3-(aminomethyl)benzoate.
Molecular Properties
| Compound Name | oxan-4-ylmethyl 3-(aminomethyl)benzoate |
| PubChem CID | 62384374 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | oxan-4-ylmethyl 3-(aminomethyl)benzoate |
| SMILES | NCc1cccc(C(=O)OCC2CCOCC2)c1 |
| InChI | InChI=1S/C14H19NO3/c15-9-12-2-1-3-13(8-12)14(16)18-10-11-4-6-17-7-5-11/h1-3,8,11H,4-7,9-10,15H2 |
| InChIKey | SESZKBCLMPAQGI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze oxan-4-ylmethyl 3-(aminomethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-ylmethyl 3-(aminomethyl)benzoate?
The IUPAC name of oxan-4-ylmethyl 3-(aminomethyl)benzoate (CID 62384374) is oxan-4-ylmethyl 3-(aminomethyl)benzoate.
What is the SMILES notation for oxan-4-ylmethyl 3-(aminomethyl)benzoate?
The canonical SMILES for oxan-4-ylmethyl 3-(aminomethyl)benzoate is NCc1cccc(C(=O)OCC2CCOCC2)c1.
What is the InChIKey of oxan-4-ylmethyl 3-(aminomethyl)benzoate?
The InChIKey is SESZKBCLMPAQGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c15-9-12-2-1-3-13(8-12)14(16)18-10-11-4-6-17-7-5-11/h1-3,8,11H,4-7,9-10,15H2.
What are the key properties of oxan-4-ylmethyl 3-(aminomethyl)benzoate?
oxan-4-ylmethyl 3-(aminomethyl)benzoate has a molecular weight of 249.31 g/mol, XLogP of 1.73, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-ylmethyl 3-(aminomethyl)benzoate is sourced from PubChem (CID 62384374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).