About oxan-4-ylmethyl 3-amino-5-ethoxybenzoate
oxan-4-ylmethyl 3-amino-5-ethoxybenzoate (PubChem CID 81092714) has the molecular formula C15H21NO4
and a molecular weight of 279.34 g/mol. Its IUPAC name is oxan-4-ylmethyl 3-amino-5-ethoxybenzoate.
Molecular Properties
| Compound Name | oxan-4-ylmethyl 3-amino-5-ethoxybenzoate |
| PubChem CID | 81092714 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | oxan-4-ylmethyl 3-amino-5-ethoxybenzoate |
| SMILES | CCOc1cc(N)cc(C(=O)OCC2CCOCC2)c1 |
| InChI | InChI=1S/C15H21NO4/c1-2-19-14-8-12(7-13(16)9-14)15(17)20-10-11-3-5-18-6-4-11/h7-9,11H,2-6,10,16H2,1H3 |
| InChIKey | BMTWUOOQKFCNCB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze oxan-4-ylmethyl 3-amino-5-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-ylmethyl 3-amino-5-ethoxybenzoate?
The IUPAC name of oxan-4-ylmethyl 3-amino-5-ethoxybenzoate (CID 81092714) is oxan-4-ylmethyl 3-amino-5-ethoxybenzoate.
What is the SMILES notation for oxan-4-ylmethyl 3-amino-5-ethoxybenzoate?
The canonical SMILES for oxan-4-ylmethyl 3-amino-5-ethoxybenzoate is CCOc1cc(N)cc(C(=O)OCC2CCOCC2)c1.
What is the InChIKey of oxan-4-ylmethyl 3-amino-5-ethoxybenzoate?
The InChIKey is BMTWUOOQKFCNCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO4/c1-2-19-14-8-12(7-13(16)9-14)15(17)20-10-11-3-5-18-6-4-11/h7-9,11H,2-6,10,16H2,1H3.
What are the key properties of oxan-4-ylmethyl 3-amino-5-ethoxybenzoate?
oxan-4-ylmethyl 3-amino-5-ethoxybenzoate has a molecular weight of 279.34 g/mol, XLogP of 2.25, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-ylmethyl 3-amino-5-ethoxybenzoate is sourced from PubChem (CID 81092714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).